summaryrefslogtreecommitdiff
path: root/MIBS/cisco/CISCO-RTTMON-TC-MIB
diff options
context:
space:
mode:
Diffstat (limited to 'MIBS/cisco/CISCO-RTTMON-TC-MIB')
-rw-r--r--MIBS/cisco/CISCO-RTTMON-TC-MIB979
1 files changed, 979 insertions, 0 deletions
diff --git a/MIBS/cisco/CISCO-RTTMON-TC-MIB b/MIBS/cisco/CISCO-RTTMON-TC-MIB
new file mode 100644
index 0000000..817b1d2
--- /dev/null
+++ b/MIBS/cisco/CISCO-RTTMON-TC-MIB
@@ -0,0 +1,979 @@
+-- *****************************************************************
+-- CISCO-RTTMON-TC-MIB.my: IP SLA Textual Conventions MIB file
+--
+-- August 2005, Katherine Yang
+--
+-- Copyright (c) 2005-2014, 2017 by Cisco Systems Inc.
+-- All rights reserved.
+--
+-- *****************************************************************
+
+CISCO-RTTMON-TC-MIB DEFINITIONS ::= BEGIN
+
+IMPORTS
+ MODULE-IDENTITY,
+ Unsigned32,
+ Integer32
+ FROM SNMPv2-SMI
+ TEXTUAL-CONVENTION
+ FROM SNMPv2-TC
+ ciscoMgmt
+ FROM CISCO-SMI;
+
+
+ciscoRttMonTCMIB MODULE-IDENTITY
+ LAST-UPDATED "201709060000Z"
+ ORGANIZATION "Cisco Systems, Inc."
+ CONTACT-INFO
+ "Cisco Systems, Inc.
+ Customer Service
+
+ Postal: 170 W Tasman Drive
+ San Jose, CA 95134
+
+ Tel: +1 800 553 NETS
+ Email: cs-ipsla@cisco.com"
+ DESCRIPTION
+ "This MIB contains textual conventions used by
+ CISCO-RTTMON-MIB, CISCO-RTTMON-RTP-MIB and
+ CISCO-RTTMON-ICMP-MIB, but they are not limited
+ to only these MIBs.
+ These textual conventions were originally defined in
+ CISCO-RTTMON-MIB.
+
+ Acronyms:
+ FEC: Forward Equivalence Class
+ LPD: Label Path Discovery
+ LSP: Label Switched Path
+ MPLS: Multi Protocol Label Switching
+ RTT: Round Trip Time
+ SAA: Service Assurance Agent
+ VPN: Virtual Private Network
+ CFM: Connection Fault Management"
+ REVISION "201708030000Z"
+ DESCRIPTION
+ "Added a new TC cipslaPercentileVar"
+ REVISION "201403190000Z"
+ DESCRIPTION
+ "Added new fabricPathEcho type to RttMonRttType and
+ fabricPathEchoAppl type to RttMonProtocol"
+ REVISION "201311260000Z"
+ DESCRIPTION
+ "Added new RttMonReactVar type named 'protocolSpecificError'"
+ REVISION "201211020000Z"
+ DESCRIPTION
+ "Added RttMonScheduleStartType TC.
+
+ Added enumeration y1731dmmv1 to RttMonProtocol.
+
+ Added the following to RttMonReactVar:
+ lpdGroup, lpdTreeTrace, lpdAll,
+ unavailSD, unavailDS, pktLossPctSD,
+ pktLossPctDS, rttPct, maxOfLatencySDPct,
+ maxOfLatencyDSPct, latencySDAvgPct, latencyDSAvgPct,
+ jitterSDAvgPct, jitterDSAvgPct, jitterAvgPct,
+ overThreshold."
+ REVISION "201205250000Z"
+ DESCRIPTION
+ "Added enumeration y1731slm to RttMonProtocol
+
+ Added the following to RttResopnseSense.
+ statsRetrieveOk, statsRetrieveNoConnect,
+ statsRetrieveVersionFail, statsRetrieveInternalError,
+ statsRetrieveAbort, statsRetrieveFail,
+ statsRetrieveAuthFail, statsRetrieveFormatError,
+ statsRetrievePortInUse.
+
+ For enumeration from controlOk to controlPortInUse, changed the
+ prefix from control to enable."
+ REVISION "201109150000Z"
+ DESCRIPTION
+ "Updated following textual conventions to include Y1731
+ and Multicast extensions.
+ -RttMonRttType, RttMonProtocol."
+ REVISION "201004260000Z"
+ DESCRIPTION
+ "Added enumeration 'video' to RttMonRttType TC."
+ REVISION "200608110000Z"
+ DESCRIPTION
+ "Added RttMonIdLst and RttMonCtrlIndex textual conventions."
+ REVISION "200607170000Z"
+ DESCRIPTION
+ "Added enumeration 'lspPingPseudowire' to RttMonRttType TC."
+ REVISION "200603020000Z"
+ DESCRIPTION
+ "Added ethernetPing and ethernetJitter in RttMonRttType.
+ Added ethernetPingAppl and ethernetJitterAppl
+ in RttMonProtocol"
+ REVISION "200508090000Z"
+ DESCRIPTION
+ "Initial version of this MIB module."
+ ::= { ciscoMgmt 485 }
+
+
+
+-- Textual Conventions
+
+RttMonScheduleStartType ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "These are defined values for scheduling the start time of a
+ probe
+
+ pending(1) - Pending state
+ now(2) - Schedule the start time of probe to current time
+ and probe is immediately started
+ random(3) - Schedule the start time of probe at a random
+ time over a range.
+ after(4) - Schedule the start time of probe after a certain
+ amount of time from now.
+ specific(5) - Schedule the start time of probe at a specific
+ given time interval"
+ SYNTAX INTEGER {
+ pending(1),
+ now(2),
+ random(3),
+ after(4),
+ specific(5)
+ }
+
+RttReset ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "When the value set to 'reset', the entire RTT application
+ goes through a reset sequence, making a best
+ effort to revert to its startup condition. At other times,
+ the value is 'ready'."
+ SYNTAX INTEGER {
+ ready(1),
+ reset(2)
+ }
+
+RttMonOperation ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "The following are specific RTT operations for a
+ particular probe type:
+ notApplicable(0) - This object is not applicable for the
+ probe type.
+ httpGet(1) - HTTP get request
+ httpRaw(2) - HTTP request with user defined payload
+ ftpGet(3) - FTP get request
+ ftpPassive(4) - FTP passive mode
+ ftpActive(5) - FTP active mode
+ voipDTAlertRinging(6) - Voip post dial delay detect point:
+ Alerting / Ringing
+ voipDTConnectOK(7) - Voip post dial delay detect point:
+ Connect /OK"
+ SYNTAX INTEGER {
+ notApplicable(0),
+ httpGet(1),
+ httpRaw(2),
+ ftpGet(3),
+ ftpPassive(4),
+ ftpActive(5),
+ voipDTAlertRinging(6),
+ voipDTConnectOK(7)
+ }
+
+-- Operation completion sense code textual convention
+
+RttResponseSense ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "These are the defined values for a completion status
+ of a RTT operation.
+
+ other(0) - the operation is not started or completed
+ or this object is not applicable for
+ the probe type.
+ ok(1) - a valid completion occurred and
+ timed successfully
+ disconnected(2) - the operation did not occur because
+ the connection to the target
+ was lost
+ overThreshold(3) - a valid completion was received but
+ the completion time exceeded a
+ threshold value
+ timeout(4) - an operation timed out; no completion
+ time recorded
+ busy(5) - the operation did not occur because a
+ previous operation is still
+ outstanding
+ notConnected(6) - the operation did not occur because no
+ connection (session) exists with the
+ target
+ dropped(7) - the operation did not occur due to lack
+ of internal resource
+ sequenceError(8) - a completed operation did not contain
+ the correct sequence id; no completion
+ time recorded
+ verifyError(9) - a completed operation was received, but
+ the data it contained did not match
+ the expected data; no completion time
+ recorded
+ applicationSpecific(10)
+ - the application generating the operation
+ had a specific error
+ dnsServerTimeout(11)
+ - DNS Server Timeout
+ tcpConnectTimeout(12)
+ - TCP Connect Timeout
+ httpTransactionTimeout(13)
+ - HTTP Transaction Timeout
+ dnsQueryError(14)
+ - DNS Query error (because of unknown address
+ etc.,)
+ httpError(15)
+ - HTTP Response StatusCode is not OK (200),
+ or permenent redirect(301), temporary redirect
+ (302) then HTTP error is set.
+ error(16)
+ - if there are socket failures or some other
+ errors not relavant to the actual probe, they
+ are recorded under this error
+ mplsLspEchoTxError(17)
+ - MPLS echo request transmission failure.
+ mplsLspUnreachable(18)
+ - MPLS Target FEC not reachable or unsupported
+ mpls echo reply code.
+ mplsLspMalformedReq(19)
+ - MPLS echo request was malformalformed, pointed
+ out by the reply router.
+ mplsLspReachButNotFEC(20)
+ - MPLS echo request processed by the downstream
+ router but not the target.
+ enableOk(21)
+ - Control enable request OK
+ enableNoConnect(22)
+ - Control enable request fail due to no connection to
+ the target.
+ enableVersionFail(23)
+ - Control enable request version fail.
+ enableInternalError(24)
+ - Control enable request internal error.
+ enableAbort(25)
+ - Control enable request abort.
+ enableFail(26)
+ - Control enable request fail.
+ enableAuthFail(27)
+ - Control enable request fail due to authentication
+ fail.
+ enableFormatError(28)
+ - Control enable request fail due to format error.
+ enablePortInUse(29)
+ - Control enable request fail due to port in use.
+ statsRetrieveOk(30)
+ - Stats retrieve request OK
+ statsRetrieveNoConnect(31)
+ - Stats retrieve request fail due to no connection
+ to the target.
+ statsRetrieveVersionFail(32)
+ - Stats retrieve request version fail.
+ statsRetrieveInternalError(33)
+ - Stats retrieve request internal error.
+ statsRetrieveAbort(34)
+ - Stats retrieve request abort.
+ statsRetrieveFail(35)
+ - Stats retrieve request fail.
+ statsRetrieveAuthFail(36)
+ - Stats retrieve request fail due to authentication fail.
+ statsRetrieveFormatError(37)
+ - Stats retrieve request fail due to format error.
+ statsRetrievePortInUse(38)
+ - Stats retrieve request fail due to port in use."
+ SYNTAX INTEGER {
+ other(0),
+ ok(1),
+ disconnected(2),
+ overThreshold(3),
+ timeout(4),
+ busy(5),
+ notConnected(6),
+ dropped(7),
+ sequenceError(8),
+ verifyError(9),
+ applicationSpecific(10),
+ dnsServerTimeout(11),
+ tcpConnectTimeout(12),
+ httpTransactionTimeout(13),
+ dnsQueryError(14),
+ httpError(15),
+ error(16),
+ mplsLspEchoTxError(17),
+ mplsLspUnreachable(18),
+ mplsLspMalformedReq(19),
+ mplsLspReachButNotFEC(20),
+ enableOk(21),
+ enableNoConnect(22),
+ enableVersionFail(23),
+ enableInternalError(24),
+ enableAbort(25),
+ enableFail(26),
+ enableAuthFail(27),
+ enableFormatError(28),
+ enablePortInUse(29),
+ statsRetrieveOk(30),
+ statsRetrieveNoConnect(31),
+ statsRetrieveVersionFail(32),
+ statsRetrieveInternalError(33),
+ statsRetrieveAbort(34),
+ statsRetrieveFail(35),
+ statsRetrieveAuthFail(36),
+ statsRetrieveFormatError(37),
+ statsRetrievePortInUse(38)
+ }
+
+-- Operation type textual convention
+
+RttMonRttType ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "Specifies the type of RTT operation to be performed.
+
+ The value 'echo' will cause the RTT application to
+ perform a timed echo request/response operation directed
+ at the 'RttMonTargetAddress'.
+
+ The value 'pathEcho' will cause the RTT application
+ to perform path discovery to the 'RttMonTargetAddress',
+ then it will perform a timed echo request/response
+ operation directed at the each hop along the path.
+ This operation will provide two types of information,
+ first the path and second the time delay along the path.
+
+ NOTE: The 'pathEcho' time delay operation is a heuristic
+ measurement because an intermediate hop may forward
+ the different echo request/response at different
+ rates. Thus the time delay difference between two
+ hops along a path may contain very little 'true'
+ statistical meaning.
+
+ The value 'fileIO' will cause the RTT application to
+ write, read, or write/read a file to a preconfigured
+ file server.
+
+ The value 'script' will cause the RTT application to
+ execute a preconfigured script.
+
+ The value 'udpEcho' will cause the RTT application
+ to perform a timed udp packet send/receive operation
+ directed at the 'RttMonTargetAddress'.
+
+ The value 'tcpConnect' will cause the RTT application
+ to perform a timed tcp connect operation directed at the
+ 'RttMonTargetAddress'.
+
+ The value 'http' will cause the RTT application
+ to perform a download of the object specified in the URL.
+
+ The value 'dns' will cause the RTT application
+ to perform a name lookup of an IP Address or a hostname.
+
+ The value 'jitter' will cause the RTT application
+ to perform delay variance analysis.
+
+ The value 'dlsw' will cause the RTT application
+ to perform a keepalive operation to measure the response
+ time of a DLSw peer.
+
+ The value 'dhcp' will cause the RTT application
+ to perform an IP Address lease request/teardown operation.
+
+ The value 'voip' will cause the RTT application
+ to perform call set up operation to measure the response.
+
+ The value 'rtp' will cause the RTT application to perform
+ delay variance analysis for RTP packet.
+
+ The value 'lspGroup' will cause the RTT application to
+ logically
+ group Label Switched Paths discovered as part of LSP Path
+ Discovery to the target and perform an RTT operation end to end
+ over each path in the Group. The type of operation configured
+ is determined by rttMplsVpnMonCtrlRttType.
+
+ The value 'icmpjitter' will cause the RTT application
+ to perform delay variance analysis using ICMP timestamp
+ packets.
+
+ The value of 'lspPingIpv4' will cause the RTT application to
+ perform ping over LSP path.
+
+ The value of 'lspTraceIpv4' will cause the RTT application to
+ perform trace over LSP path.
+
+ The value of 'ethernetPing' will cause the RTT application to
+ perform delay variance analysis using regular 802.1ag loopback
+ frame.
+
+ The value of 'ethernetJitter' will cause the RTT application to
+ perform delay variance analysis using CFM frame.
+
+ The value of 'lspPingPseudowire' will cause the RTT application
+ to perform LSP Ping over Pseudowire and measure response time.
+
+ The value 'video' will cause the the RTT application to perform
+ a video stream analysis directed at the 'RttMonTargetAddress'.
+
+ The value 'y1731Delay' will cause the RTT application to
+ perform
+ a ITU-T standard Y.1731 delay variance analysis.
+
+ The value 'y1731Loss' will cause the RTT application to perform
+ a ITU-T standard Y.1731 loss measure analysis.
+
+ The value 'mcastJitter' will cause the RTT application to
+ perform udp jitter stream analysis on a multicast network.
+
+ The value 'fabricPathEcho' will cause the RTT application to
+ perform delay performance measurment and verify connectivity in
+ a Fabric Path Network."
+ SYNTAX INTEGER {
+ echo(1),
+ pathEcho(2),
+ fileIO(3),
+ script(4),
+ udpEcho(5),
+ tcpConnect(6),
+ http(7),
+ dns(8),
+ jitter(9),
+ dlsw(10),
+ dhcp(11),
+ ftp(12),
+ voip(13),
+ rtp(14),
+ lspGroup(15),
+ icmpjitter(16),
+ lspPing(17),
+ lspTrace(18),
+ ethernetPing(19),
+ ethernetJitter(20),
+ lspPingPseudowire(21),
+ video(22),
+ y1731Delay(23),
+ y1731Loss(24),
+ mcastJitter(25),
+ fabricPathEcho(26)
+ }
+
+-- Operation type for Auto SAA L3 MPLS VPN textual convention
+
+RttMplsVpnMonRttType ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "Specifies the type of RTT operation to be performed for
+ Auto SAA L3 MPLS VPN.
+
+ The value 'jitter' will cause the Auto SAA L3 MPLS VPN to
+ automatically configure jitter operations.
+
+ The value 'echo' will cause the Auto SAA L3 MPLS VPN to
+ automatically configure jitter operations.
+
+ The value 'pathEcho' will cause the Auto SAA L3 MPLS VPN to
+ automatically configure jitter operations."
+ SYNTAX INTEGER {
+ jitter(1),
+ echo(2),
+ pathEcho(3)
+ }
+
+-- --
+-- Auto SAA L3 MPLS VPN LSP Path Discovery
+-- Failure Cause textual convention
+
+RttMplsVpnMonLpdFailureSense ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "These are the defined values for the causes of failure in
+ LSP Path Discovery.
+
+ unknown(1) - The cause of failure for the
+ LSP Path Discovery cannot be
+ determined. The discovery for
+ the target PE may not have
+ started.
+ noPath(2) - No paths were found to the
+ target FEC while doing the
+ LSP Path Discovery.
+ allPathsBroken(3) - All paths to the target FEC
+ are broken. This means an
+ untagged interface on the LSP
+ to the target.
+ allPathsUnexplorable(4) - All paths to the target FEC are
+ unexplorable. This identifies
+ a case where there is some
+ problem in reaching the next
+ hop while doing Discovery.
+ allPathsBrokenOrUnexplorable(5) - All paths to the target FEC are
+ are either broken or
+ unexplorable.
+ timeout(6) - The LSP Path Discovery could
+ not be completed for the
+ target FEC within the
+ configured time.
+ error(7) - Error occurred while
+ performing LSP Path Discovery.
+ It might be also due to some
+ reasons unrelated to LSP Path
+ Discovery."
+ SYNTAX INTEGER {
+ unknown(1),
+ noPath(2),
+ allPathsBroken(3),
+ allPathsUnexplorable(4),
+ allPathsBrokenOrUnexplorable(5),
+ timeout(6),
+ error(7)
+ }
+
+-- textual convention
+
+RttMplsVpnMonLpdGrpStatus ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "These are the defined values for the status of the LPD Group.
+
+ unknown(1) - This indicates that some/all of the probes which are
+ part of the LPD group have not completed even
+ a single operation, so the group status cannot be
+ identified.
+ up(2) - This state indicates that all the probes which are
+ part of the LPD group are up with latest return
+ code as 'ok'.
+ partial(3) - This state indicates that some probes are up and
+ running fine and some are not 'ok'.
+ down(4) - This state indicates that all the probes to the
+ target are not running fine. This state indicates
+ that there is connectivity problem to the target
+ PE."
+ SYNTAX INTEGER {
+ unknown(1),
+ up(2),
+ partial(3),
+ down(4)
+ }
+
+RttMonProtocol ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "Specifies the protocol to be used to perform the timed
+ echo request/response. The following protocols are
+ defined:
+
+ NOTE: All protocols that end in 'Appl' will support
+ the asymetric request/response (ARR) protocol.
+ See the DESCRIPTION for ciscoRttMonMIB for a
+ complete description of the asymetric
+ request/response protocol.
+
+ notApplicable - no protocol is defined
+ ipIcmpEcho - uses Echo Request/Reply as defined
+ in RFC792 for Internet Protocol
+ networks
+ ipUdpEchoAppl - uses the UDP based echo server
+ snaRUEcho - uses the REQECHO and ECHOTEST RU's
+ to an SSCP over an SNA LU-SSCP
+ session
+ snaLU0EchoAppl - uses test RU's sent to the Echo
+ Server over an SNA LU0-LU0 session
+ snaLU2EchoAppl - uses test RU's sent to the Echo
+ Server over an SNA LU2-LU2 session
+ snaLU62Echo - uses the native appn ping ie. aping
+ snaLU62EchoAppl - uses test RU's sent to the ARR
+ Echo Server over an SNA LU6.2-LU6.2
+ session
+ appleTalkEcho - uses Echo Request/Reply as defined
+ for appleTalk networks
+ appleTalkEchoAppl - uses the appleTalk based echo
+ server
+ decNetEcho - uses Echo Request/Reply as defined
+ for DECNet networks
+ decNetEchoAppl - uses the DECnet based echo server
+ ipxEcho - uses Echo Request/Reply as defined
+ for Novell IPX networks
+ ipxEchoAppl - uses the Novel IPX based echo
+ server
+ isoClnsEcho - uses Echo Request/Reply as defined
+ for ISO CLNS networks
+ isoClnsEchoAppl - uses the ISO CLNS based echo
+ server
+ vinesEcho - uses Echo Request/Reply as defined
+ for VINES networks
+ vinesEchoAppl - uses the VINES based echo server
+ xnsEcho - uses Echo Request/Reply as defined
+ for XNS networks
+ xnsEchoAppl - uses the XNS based echo server
+ apolloEcho - uses Echo Request/Reply as defined
+ for APOLLO networks
+ apolloEchoAppl - uses the APOLLO based echo
+ server
+ netbiosEchoAppl - uses the netbios based echo
+ server
+ ipTcpConn - uses the tcp's connect mechanism
+ httpAppl - uses udp for name resolution,
+ tcp connect and tcp data transfer
+ mechanisms for HTTP data download
+ from a particular HTTP Server
+ dnsAppl - uses udp for name resolution
+ jitterAppl - uses udp for packet transfers
+ dlswAppl - uses tcp for sending keepalives
+ dhcpAppl - uses udp for sending dhcp requests
+ ftpAppl - uses tcp for connect & data transfer
+ mplsLspPingAppl - uses MPLS Echo Request/Response as per
+ draft-ietf-mpls-lsp-ping-04 ietf
+ standard
+ voipAppl - uses Symphony infrastructure to measure
+ H.323/SIP call set up time
+ rtpAppl - uses Symphony infrastructure to measure
+ rtp packets delay variance.
+ icmpJitterAppl - uses ICMP Timestamp for packet transfer
+ to measure jitter.
+ ethernetPingAppl - uses regular 802.1ag loopback frame
+ ethernetJitterAppl - uses CFM frames .
+ videoAppl - uses synthetic traffic depending on video
+ profile
+ y1731dmm - used to measure Y1731 delay
+ y17311dm - used to measure Y1731 1DM
+ y1731lmm - used to measure Y1731 Loss measurement
+ mcastJitterAppl - uses udp jitter to measure multicast
+ network performance
+ y1731slm - used to measure Y1731 Synthetic Loss
+ measurement
+ y1731dmmv1 - used to measure Y1731 DMMv1 measurement
+
+ fabricPathEchoAppl - uses Fabric Path connect mechanism"
+ SYNTAX INTEGER {
+ notApplicable(1),
+ ipIcmpEcho(2),
+ ipUdpEchoAppl(3),
+ snaRUEcho(4),
+ snaLU0EchoAppl(5),
+ snaLU2EchoAppl(6),
+ snaLU62Echo(7),
+ snaLU62EchoAppl(8),
+ appleTalkEcho(9),
+ appleTalkEchoAppl(10),
+ decNetEcho(11),
+ decNetEchoAppl(12),
+ ipxEcho(13),
+ ipxEchoAppl(14),
+ isoClnsEcho(15),
+ isoClnsEchoAppl(16),
+ vinesEcho(17),
+ vinesEchoAppl(18),
+ xnsEcho(19),
+ xnsEchoAppl(20),
+ apolloEcho(21),
+ apolloEchoAppl(22),
+ netbiosEchoAppl(23),
+ ipTcpConn(24),
+ httpAppl(25),
+ dnsAppl(26),
+ jitterAppl(27),
+ dlswAppl(28),
+ dhcpAppl(29),
+ ftpAppl(30),
+ mplsLspPingAppl(31),
+ voipAppl(32),
+ rtpAppl(33),
+ icmpJitterAppl(34),
+ ethernetPingAppl(35),
+ ethernetJitterAppl(36),
+ videoAppl(37),
+ y1731dmm(38),
+ y17311dm(39),
+ y1731lmm(40),
+ mcastJitterAppl(41),
+ y1731slm(42),
+ y1731dmmv1(43),
+ fabricPathEchoAppl(44)
+ }
+
+RttMonCodecType ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "Specifies the codec type to be used with the jitter probe.
+ The following codec types are defined:
+
+ notApplicable - no CodecType is defined
+ g711ulaw - uses G.711 U Law 64000 bps
+ g711alaw - uses G.711 A Law 64000 bps
+ g729a - uses G.729 8000 bps"
+ SYNTAX INTEGER {
+ notApplicable(0),
+ g711ulaw(1),
+ g711alaw(2),
+ g729a(3)
+ }
+
+RttMonLSPPingReplyMode ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "Specifies the Reply mode for the MPLS LSP Echo request
+ packets. The following reply modes are supported:
+
+ replyIpv4Udp(1) - an mpls echo request will normally
+ have reply via IPv4 UDP packets.
+ replyIpv4UdpRA(2) - reply via IPv4 UDP Router Alert. Used
+ when IPv4 return path is deemed
+ unreliable."
+ SYNTAX INTEGER {
+ replyIpv4Udp(1),
+ replyIpv4UdpRA(2)
+ }
+
+RttMonTargetAddress ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "A string which specifies the address of the target for
+ the RTT operation; a value of RttMonTargetAddress
+ which corresponds to a 'broadcast' address is disallowed.
+
+ The interpretation of this string depends on the type of
+ RTT operation selected, as specified by RttMonProtocol;
+ consequently, this object cannot be created until
+ RttMonProtocol has been created (or must be in the same
+ PDU).
+
+ SNA addresses will be provided in ASCII, but will be
+ converted to EBCDIC
+
+ It is interpreted as follows, for the specified values of
+ RttMonProtocol:
+
+ ipIcmpEcho, ipUdpEchoAppl, ipTcpConn, jitterAppl, dlswAppl,
+ dnsAppl, httpAppl, and dhcpAppl
+ - 4 octets
+
+ snaRUEcho
+ - N octets, containing the value of the sna
+ HOSTNAME of which the SSCP LU will be used
+ for the operation. For many systems this value
+ can be empty, and the system will use the
+ implied SSCP LU. For example 'NSPECHO'.
+
+ snaLU0EchoAppl and snaLU2EchoAppl
+ - N octets, the first x octets are the HOSTNAME
+ (Alternatively, this could be a PU name defined
+ to transport to the desired HOST), the second
+ y octets are the APPLID, and the last z octets
+ are the MODENAME of the Echo Server (blank
+ for a MODENAME default). The address will be
+ encoded with a size byte preceding each of
+ the x y and z called s. For example sxsysz
+ as in '0x06CWBC060x07NSPECHO0x00' where
+ HOSTNAME = CWBC06, APPLID = NSPECHO, and
+ MODENAME is defaulted to 8 blanks.
+ NOTE: MODENAME is either size 0 or 8.
+
+ snaLU62Echo and snaLU62EchoAppl
+ - N octets, the first x octets are the LU-NAME,
+ the second y octets are the TP-NAME, and the
+ last z octets are the MODENAME of the Echo
+ Server. The address will be encoded with a size
+ byte preceding each of the x y and z called s.
+ For example sxsysz (zero size before z for a
+ MODENAME default). The LU-NAME is composed of
+ 8 bytes '.' 8 bytes. The Transaction Program
+ name (TP-NAME) is 1-64 bytes. The MODENAME
+ is 8 bytes.
+
+ appleTalkEcho, appleTalkEchoAppl
+
+ decNetEcho, decNetEchoAppl
+
+ ipxEcho, ipxEchoAppl
+
+ isoClnsEcho, isoClnsEchoAppl
+
+ vinesEcho, vinesEchoAppl
+
+ xnsEcho, xnsEchoAppl
+ apolloEcho, apolloEchoAppl
+
+ netbiosEchoAppl, voipAppl
+ - unsupported protocols.
+
+ mplsLspPingAppl
+ - 8 octets, the first 4 octets are the FEC address
+ and the next 4 octets are the FEC address mask."
+ SYNTAX OCTET STRING
+
+RttMonReactVar ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "The following are specific Reaction variables for a
+ particular probe type:
+ rtt(1) - Round Trip Time
+ jitterSDAvg(2) - Jitter average from source to Destination
+ jitterDSAvg(3) - Jitter average from destination to source
+ packetLossSD(4) - Packet loss from source to destination
+ packetLossDS(5) - Packet loss from destination to source
+ mos(6) - Mean Opinion Score
+ timeout(7) - Timeout of the Operation
+ connectionLoss(8) - Connection Failed to the destination
+ verifyError(9) - Data corruption occurs
+ jitterAvg(10) - Jitter Average in both the directions
+ icpif(11) - Calculated Planning Impairment Factor
+ packetMIA(12) - Missing In Action
+ packetLateArrival(13) - Packets arriving Late
+ packetOutOfSequence(14) - Packets arriving out of sequence
+ maxOfPositiveSD(15) - Maximum positive jitter from
+ Source to Destination
+ maxOfNegativeSD(16) - Maximum negative jitter from
+ Source to Destination
+ maxOfPositiveDS(17) - Maximum positive jitter from
+ Destination to Source
+ maxOfNegativeDS(18) - Maximum negative jitter from
+ Destination to Source.
+ iaJitterDS(19) - Inter arrival jitter from
+ Destination to Source
+ frameLossDS(20) - Number of frame loss recorded
+ at source DSP
+ mosLQDS(21) - Listener quality MOS at Source
+ mosCQDS(22) - Conversational quality MOS at source
+ rFactorDS(23) - R-Factor value at Destination.
+ successivePacketLoss(24)- Successive Dropped Packet
+ maxOfLatencyDS(25) - Maximum Latency from Destination
+ to Source
+ maxOfLatencySD(26) - Maximum Latency from Source
+ to Destination
+ latencyDSAvg(27) - Latency average from Destination
+ to Source
+ latencySDAvg(28) - Latency average from Source
+ to Destination
+ packetLoss(29) - Packets loss in both directions
+ iaJitterSD(30) - Inter arrival jitter from
+ Source to Destination
+ mosCQSD(31) - Conversational quality MOS at
+ Destination
+ rFactorSD(32) - R-Factor value at Destination.
+ lpdGroup(33) - Label Path Discovery (LPD) group
+ lpdTreeTrace(34) - LPD Tree Trace
+ lpdAll(35) - LPD All
+ unavailSD(36) - Unavailability threshold crossing
+ crossing - Source to Destination
+ unavailDS(37) - Unavailability threshold crossing
+ crossing - Destination to source
+ pktLossPctSD(38) - Loss ratio threshold crossing
+ based on percent - Source to
+ Destination
+ pktLossPctDS(39) - Loss ratio threshold crossing
+ based on percent - Destination to
+ Source
+ rttPct(40) - Percentile Round Trip Time
+ maxOfLatencySDPct(41) - Percentile Maximum Latency from
+ Source to Destination
+ maxOfLatencyDSPct(42) - Percentile Maximum Latency from
+ Destination to Source
+ latencySDAvgPct(43) - Percentile Latency Average from
+ Source to Destination
+ latencyDSAvgPct(44) - Percentile Latency Average from
+ Destination to Source
+ jitterSDAvgPct(45) - Percentile Jitter Average from
+ Source to Destination
+ jitterDSAvgPct(46) - Percentile Jitter Average from
+ Destination to Source
+ jitterAvgPct(47) - Percentile Jitter Average in
+ both directions
+ overThreshold(48) - Percent of Round Trip Times
+ over threshold.
+ protocolSpecificError(49)-Any protocol specific error."
+ SYNTAX INTEGER {
+ rtt(1),
+ jitterSDAvg(2),
+ jitterDSAvg(3),
+ packetLossSD(4),
+ packetLossDS(5),
+ mos(6),
+ timeout(7),
+ connectionLoss(8),
+ verifyError(9),
+ jitterAvg(10),
+ icpif(11),
+ packetMIA(12),
+ packetLateArrival(13),
+ packetOutOfSequence(14),
+ maxOfPositiveSD(15),
+ maxOfNegativeSD(16),
+ maxOfPositiveDS(17),
+ maxOfNegativeDS(18),
+ iaJitterDS(19),
+ frameLossDS(20),
+ mosLQDS(21),
+ mosCQDS(22),
+ rFactorDS(23),
+ successivePacketLoss(24),
+ maxOfLatencyDS(25),
+ maxOfLatencySD(26),
+ latencyDSAvg(27),
+ latencySDAvg(28),
+ packetLoss(29),
+ iaJitterSD(30),
+ mosCQSD(31),
+ rFactorSD(32),
+ lpdGroup(33),
+ lpdTreeTrace(34),
+ lpdAll(35),
+ unavailSD(36),
+ unavailDS(37),
+ pktLossPctSD(38),
+ pktLossPctDS(39),
+ rttPct(40),
+ maxOfLatencySDPct(41),
+ maxOfLatencyDSPct(42),
+ latencySDAvgPct(43),
+ latencyDSAvgPct(44),
+ jitterSDAvgPct(45),
+ jitterDSAvgPct(46),
+ jitterAvgPct(47),
+ overThreshold(48),
+ protocolSpecificError(49)
+ }
+
+RttMonIdLst ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "A string that specifies a list of the IP SLA probe
+ identifiers or other numeric identifiers.
+ The identifiers will be specified in the following form.
+ (a) Individual identifiers with comma separated as 1,5,3.
+ (b) Range form including hyphens with multiple ranges
+ being
+ separated by comma as 1-10,12-34.
+ (c) Mix of the above two forms as 1,2,4-10,12,15,19-25."
+ SYNTAX OCTET STRING (SIZE (0..255))
+
+RttMonCtrlIndex ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "The value of this object identifies the row in the
+ ipslaEthernetGrpCtrlTable and ipslaEthernetGrpReactTable.
+ It can be used for other IP SLA control tables."
+ SYNTAX Unsigned32 (1..2147483647)
+
+CipslaPercentileVar ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "The following are specific percentile types. These types are
+ supported by UDP Jitter, ICMP Jitter and Ethernet Jitter
+ probes:
+ rtt(1) - Round Trip Time
+ owsd(2) - One way delay - Source to Destination
+ owds(3) - One way delay - Destination to Source
+ jittersd(4) - One way jitter - Source to Destination
+ jitterds(5) - One way jitter - Destination to Source
+ jitteravg(6) - Jitter values in both directions."
+ SYNTAX INTEGER {
+ rtt(1),
+ owsd(2),
+ owds(3),
+ jittersd(4),
+ jitterds(5),
+ jitteravg(6)
+ }
+
+END
generated by cgit v1.2.3 (git 2.46.0) at 2026-02-26 18:41:30 +0000